Algebra 3 Quiz: Arithmetic Sequences And Series
20 questions · exam conditions
0:00
Arithmetic Sequences And SeriesQuestion 1 of 20

An arithmetic sequence is given by an=4n7a_n = 4n - 7. What is S25S_{25}, the sum of the first 25 terms?

11251125
11751175
10751075
22502250
← Back to quizzes

Algebra 3 Quiz

Algebra 3 Quiz: Arithmetic Sequences And Series

Practice Arithmetic Sequences And Series in Algebra 3 with focused quiz questions that help you check what you know, review explanations, and build confidence with test-style prompts.

What this quiz covers

This quiz focuses on Arithmetic Sequences And Series, giving you a quick way to practice the rules, question types, and explanations that matter most for Algebra 3.

How to use this quiz

Try each quiz question before looking at the correct answer. Use the explanations to review missed ideas, then come back to similar questions until the pattern feels familiar.

All questions

Question 1

An arithmetic sequence is given by an=4n7a_n = 4n - 7. What is S25S_{25}, the sum of the first 25 terms?

  1. 11251125 (correct answer)
  2. 11751175
  3. 10751075
  4. 22502250
Explanation: An arithmetic sequence has a constant difference between consecutive terms. Here, an=4n7a_n = 4n - 7 tells you directly that a1=47=3a_1=4-7=-3, and that the common difference is 4. For any arithmetic series, use the formula Sn=n2(a1+an).S_n = \frac{n}{2}(a_1+a_n). For n=25n=25, compute the last term first: a_{25}=4(25)-7=100-7=93. $$ $$ S_{25}=\frac{25}{2}(-3+93) =\frac{25}{2}(90) =25\cdot45=1125. So 1125 is the correct sum. The wrong choices come from common slips. 22502250 results from using 25(90)25(90) instead of 252(90)\frac{25}{2}(90)—forgetting the half. 10751075 results from accidentally using the 24th term, a24=89a_{24}=89, as the last term: 252(3+89)=1075\frac{25}{2}(-3+89)=1075. 11751175 results from going the other way and using the 26th term, a26=97a_{26}=97: 252(3+97)=1175\frac{25}{2}(-3+97)=1175. Both are off-by-one indexing errors. When you see a question asking for S25S_{25}, make sure the term index matches the number of terms: the last term included must be a25a_{25}, not a24a_{24} or a26a_{26}. A quick check of a1a_1, a25a_{25}, and the half in the formula will keep you accurate.

Question 2

In an arithmetic sequence, a1=5a_1=5 and S8=124S_8=124. What is the common difference dd?

  1. 3131
  2. 218\frac{21}{8}
  3. 134\frac{13}{4}
  4. 33 (correct answer)
Explanation: An arithmetic sequence is linear: each term is the previous term plus dd. When you know the first term, the number of terms, and the sum, the key formula is Sn=n2(2a1+(n1)d).S_n=\frac{n}{2}(2a_1+(n-1)d). Plug in n=8n=8, a1=5a_1=5, and S8=124S_8=124: 124=82(2(5)+7d)=4(10+7d)=40+28d.124=\frac{8}{2}(2(5)+7d)=4(10+7d)=40+28d. So 84=28d84=28d, giving d=3d=3. The common difference is therefore 33. The choice 3131 is a trap: since S8=4(a1+a8)S_8=4(a_1+a_8), you get a1+a8=31a_1+a_8=31, but that is the sum of the first and eighth terms, not the common difference. The choice 218\frac{21}{8} comes from using a8=a1+8da_8=a_1+8d instead of a1+7da_1+7d, which gives 124=40+32d124=40+32d. The choice 134\frac{13}{4} often comes from taking that 3131 as if it were a8a_8, then computing (315)/8=26/8=13/4(31-5)/8=26/8=13/4. That compounds two mistakes: 3131 is not a8a_8, and there are only 77 gaps from a1a_1 to a8a_8. Remember: with nn terms, the last term uses n1n-1 differences. Also, 2Snn\frac{2S_n}{n} gives a1+ana_1+a_n, not ana_n alone. Check your indexing before dividing.

Question 3

In an arithmetic sequence, the 3rd term is 1919 and the 8th term is 44. What is the sum of all positive terms?

  1. 116116
  2. 115115
  3. 117117 (correct answer)
  4. 112112
Explanation: Whenever you see an arithmetic sequence question, your first move is to find the common difference. Here, the 3rd term is 1919 and the 8th term is 44. Since there are 55 steps from term 3 to term 8, the difference is 4195=3\frac{4-19}{5}=-3. Working backward, the first term is 192(3)=2519 - 2(-3)=25, so the sequence is 25,22,19,25, 22, 19, \dots. A term is positive as long as 25+(n1)(3)>025+(n-1)(-3)>0, which gives n<913n<9\tfrac{1}{3}, so the positive terms are terms 1 through 9. The 9th term is 25+8(3)=125+8(-3)=1. The sum of the first 9 terms is 92(25+1)=117\frac{9}{2}(25+1)=117. The other choices come from stopping at the wrong place. 116116 is the sum of the first 8 terms, so it leaves out the 9th term, which is still positive 11. 115115 is the sum of the first 10 terms, but the 10th term is 2-2, and negative terms should not be included. 112112 is the sum of the first 7 terms, stopping before the positive 8th term 44 and 9th term 11 are added. For any arithmetic sequence sum question, first determine the common difference, then carefully identify exactly which terms satisfy the condition—here, being positive. Counting one term too few or too many is the most common trap.

Question 4

For an arithmetic sequence, S10=200S_{10}=200 and S20=800S_{20}=800. What is S30S_{30}?

  1. 12001200
  2. 14001400
  3. 18001800 (correct answer)
  4. 10001000
Explanation: Whenever you see a question like this with S_{10}}, S_{20}}, and S30S_{30}, think in blocks of 10 terms. For an arithmetic sequence, sums over equal-sized blocks also form an arithmetic sequence. That's he key to this problem. Let the sums of he first, second, and third blocks of 10 terms be B1B_1, B2B_2, B3B_3. You know B1=S10=200B_1=S_{10}=200. And B2=S20S10=800200=600B_2=S_{20}-S_{10}=800-200=600. Since block sums form an arithmetic sequence, he gap between them is constant: 600200=400600-200=400. So the next block sum is B3=600+400=1000B_3=600+400=1000. Therefore S30=S20+B3=800+1000=1800S_{30}=S_{20}+B_3=800+1000=1800. That is the correct result. The 12001200 choice comes from scaling 800800 by 30/2030/20, assuming the total is proportional to he number of terms. But the average per term is not constant in an arithmetic sequence; here it increases, so 12001200 is too low. The 14001400 choice comes from adding the change S_{20}-S_{10}}=600 again to S20S_{20}. That treats the second block sum as if it were also he third block sum, but he third block is actually 10001000. The 10001000 choice simply adds S10+S20S_{10}+S_{20}, which has no valid meaning for partial sums. Study tip: for arithmetic sequences, always compare equal-sized blocks. The block sums arehemselves arithmetic, so use their constant difference — not he terms' common difference directly — to extend partial sums.

Question 5

The sum of the first nn terms of an arithmetic series is given by Sn=3n2nS_n = 3n^2 - n. What is the common difference?

  1. 33
  2. 66 (correct answer)
  3. 22
  4. 88
Explanation: Whenever you see the sum of the first nn terms of an arithmetic series written as a quadratic like S_n = ̂3n^2 - n, think about the general form. For an arithmetic series, Sn=n2[2a+(n1)d]=d2n2+(ad2)n.S_n = \frac n2\left[2a + (n-1)d\right] = \frac d2 n^2 + \left(a - \frac d2\right)n. So the coefficient of n2n^2 is d2\frac d2, not simply dd. Here the coefficient is 33, so \frac d2 = ̂3, which gives d=6d=6. That is why the correct answer is 66. The distractor 33 is just the coefficient of n2n^2; students often mistake it for the common difference, but it is only half of dd. The choice 22 might come from confusing the coefficient of nn with the difference, or from dividing 66 by something incorrectly;it has no direct role in the sum formula's leading coefficient. The choice 88 could result from an arithmetic slip like 3\cdot 2 + ̂2, but there is no support for it in the comparison. For your study tip: on this exam, whenever an arithmetic series sum is given as Sn=an2+bnS_n = an^2 + bn, the common difference is always 2a2a. Remember the factor of 22 comes from the formula's d2n2\frac d2 n^2. Then check the linear coefficient if needed to find the first term, but the difference is determined entirely by the quadratic coefficient.

Question 6

In the arithmetic sequence an=3n+2a_n = 3n + 2, what is the sum of the terms from a6a_6 through a10a_{10}, inclusive?

  1. 156156
  2. 130130 (correct answer)
  3. 185185
  4. 5555
Explanation: Whenever you need the sum of consecutive terms in an arithmetic sequence, your first move is to identify the endpoints and the number of terms. For an inclusive range, the count is last index minus first index plus one. Here, a6=3(6)+2=20a_6 = 3(6)+2 = 20 and a10=3(10)+2=32a_{10}=3(10)+2=32. From a6a_6 through a10a_{10} inclusive there are 106+1=510-6+1=5 terms, and the average of the first and last terms is 20+322=26\frac{20+32}{2}=26. So the sum is 526=1305\cdot 26=130. The distractor 156156 comes from an off-by-one error: if you mistakenly count 6 terms, 626=1566\cdot 26=156. Remember that a6,a7,a8,a9,a10a_6, a_7, a_8, a_9, a_{10} is only five terms. The choice 185185 is the sum of the first ten terms, a1a_1 through a10a_{10}, since 10(5+32)2=185\frac{10(5+32)}{2}=185; that includes a1a_1 through a5a_5, which are not wanted. The choice 5555 is the sum of the first five terms, a1a_1 through a5a_5, because 5(5+17)2=55\frac{5(5+17)}{2}=55; it starts at the wrong endpoint. For inclusive sums, always calculate the term count as n=lastfirst+1n = \text{last} - \text{first} + 1. If the range is small, listing the terms quickly (20+23+26+29+3220+23+26+29+32) can also help you avoid endpoint errors.

Question 7

What is the sum of all integers from 13-13 through 4747, inclusive?

  1. 799799
  2. 10201020
  3. 10541054
  4. 10371037 (correct answer)
Explanation: When you see "sum of all integers from aa through bb, inclusive," you're finding an arithmetic series. The key formula is: count=ba+1,sum=count×a+b2.\text{count} = b - a + 1, \quad \text{sum} = \text{count} \times \frac{a + b}{2}. Here a=13a=-13, b=47b=47, so the count is 47(13)+1=61,47 - (-13) + 1 = 61, and the average of the first and last terms is 13+472=342=17.\frac{-13 + 47}{2} = \frac{34}{2} = 17. Thus, 61×17=1037.61 \times 17 = 1037. That is the correct sum. Notice the pair structure: the 61 terms have middle value 1717, so your sum is 3030 pairs of sum 3434 plus the middle 1717, which also gives 30×34+17=103730 \times 34 + 17 = 1037. The choice 799799 comes from using 4747 as the number of terms: 47×17=79947 \times 17 = 799. But 4747 is just the endpoint, not the count — the count includes the negative numbers and zero, so it must be 6161. The choice 10201020 is 60×1760 \times 17. That happens if you compute the count as 47(13)=6047 - (-13) = 60, forgetting to add 11 for "inclusive." You need that extra term, which is the middle 1717. The choice 10541054 is 62×1762 \times 17. That trap comes from adding 11 twice — treating both endpoints as extra. But the difference 6060 already measures gaps; for inclusive endpoints, add exactly one, giving 6161. Study takeaway: for any consecutive integer sum, always write the count first: lastfirst+1\text{last} - \text{first} + 1. If your count times the average is around 10001000, you can sanity-check against 61×1761 \times 17.

Question 8

The 9th term of an arithmetic sequence is 14-14, and the 17th term is 2626. Which formula gives the nth term of this sequence?

  1. an=5n59a_n=5n-59 (correct answer)
  2. an=5n54a_n=5n-54
  3. an=5n49a_n=5n-49
  4. an=5n64a_n=5n-64
Explanation: Whenever a problem gives you two terms of an arithmetic sequence, your job is to find the common difference dd and then the starting term a1a_1. Here the 17th and 9th terms are separated by 179=817-9=8 positions, and the value increases by 26(14)=4026-(-14)=40. So d=408=5d=\frac{40}{8}=5. Now use the 9th term to step back to a1a_1: a9=a1+8(5)a_9=a_1+8(5), so 14=a1+40-14=a_1+40, which gives a1=54a_1=-54. Thus the nth term is an=a1+(n1)d=54+5(n1)=5n59a_n=a_1+(n-1)d=-54+5(n-1)=5n-59. Plugging in n=9n=9 gives 14-14, and n=17n=17 gives 2626, so this formula matches the data. Each wrong choice has slope 55 but the wrong intercept. The formula 5n545n-54 comes from writing an=54+5na_n=-54+5n instead of 54+5(n1)-54+5(n-1); that forgets the crucial (n1)(n-1) shift. The formula 5n495n-49 is off by +10+10: substituting n=9n=9 gives 4-4, not 14-14. The formula 5n645n-64 is off by 5-5: substituting n=9n=9 gives 19-19. A common source of that last error is finding a1=2617(5)=59a_1=26-17(5)=-59 by using 1717 steps back from the 17th term, rather than 1616 steps. That off-by-one mistake creates an intercept that is 55 too small. So when you solve this type of problem, always compute dd first, then find a1a_1 by stepping back with (term index1)d(\text{term index}-1)d. Finally, test your formula by plugging in one of the given term numbers—that catches intercept errors quickly.

Question 9

Five arithmetic means are inserted between 88 and 4444. What is the sum of the five inserted means?

  1. 182182
  2. 130130 (correct answer)
  3. 156156
  4. 174174
Explanation: Whenever you insert arithmetic means, think of them as terms of one arithmetic sequence: the endpoints are the first and last terms, and each inserted mean is a term in between. Here five means are inserted, so the sequence has 77 terms total. The common difference is d=4485+1=6.d=\frac{44-8}{5+1}=6. So the five means are 14,20,26,32,3814,20,26,32,38, and their sum is 14+20+26+32+38=130.14+20+26+32+38=130. Notice that the sum of all seven terms is 8+4427=182\frac{8+44}{2}\cdot 7=182. That explains the trap behind 182: it is the total of everything, including both endpoints. The choice 156 would result from mistakenly inserting six means instead of five, since six means would have sum 626=1566\cdot 26=156. The choice 174 equals 14+20+26+32+38+4414+20+26+32+38+44, so it includes the last endpoint but still leaves out the first endpoint 88. When you see "arithmetic means," set up the sequence immediately: first term is the lower endpoint, last term is the upper endpoint, and the number of terms is the number of means plus 22. Then use d=lastfirstnumber of means+1d=\frac{\text{last}-\text{first}}{\text{number of means}+1} and list the means. This protects you from both endpoint and interval-counting mistakes.

Question 10

The sum of the first nn terms of the arithmetic sequence 5,9,13,5, 9, 13, \ldots is 860860. What is nn?

  1. 1818
  2. 1919
  3. 2121
  4. 2020 (correct answer)
Explanation: Whenever you see a question about the sum of an arithmetic sequence, start by naming the first term and common difference. Here, a=5a=5 and d=4d=4, so the sum of the first nn terms is Sn=n2(2(5)+(n1)(4))=n2(4n+6)=2n2+3n.S_n=\frac{n}{2}\left(2(5)+(n-1)(4)\right)=\frac{n}{2}(4n+6)=2n^2+3n. Set this equal to 860: 2n2+3n=8602n2+3n860=0.2n^2+3n=860 \Rightarrow 2n^2+3n-860=0. Using the quadratic formula, the discriminant is 324(2)(860)=6889=8323^2-4(2)(-860)=6889=83^2, so n=3±834.n=\frac{-3\pm 83}{4}. The positive solution is n=804=20n=\frac{80}{4}=20, and the negative solution is discarded because nn must be positive. To confirm, the 20th term is 5+19(4)=815+19(4)=81, and the average of the first and last terms is 5+812=43\frac{5+81}{2}=43. Multiplying by 20 terms gives 2043=86020\cdot 43=860. Now consider the wrong answers. Choosing 18 gives a sum of 2(18)2+3(18)=7022(18)^2+3(18)=702, which is too low. Choosing 19 gives 2(19)2+3(19)=7792(19)^2+3(19)=779, still short of 860. Choosing 21 gives 2(21)2+3(21)=9452(21)^2+3(21)=945, which overshoots the target. These errors often come from forgetting to use the n1n-1 term inside the parentheses, or from solving the quadratic incorrectly. On exam day, remember: for arithmetic sums, identify aa and dd, write the formula, and set it equal to the given sum. Then solve the quadratic and reject any negative or non-integer root.

Question 11

An auditorium has 20 rows of seats. Row 1 contains 20 seats, row 9 contains 44 seats, and the number of seats in consecutive rows increases by a constant amount. What is the total number of seats in the auditorium?

  1. 970970 (correct answer)
  2. 10001000
  3. 19401940
  4. 20002000
Explanation: Whenever you see consecutive quantities increasing by a constant amount, you are working with an arithmetic sequence. Here the row counts are the terms, so find the common difference first. Row 1 has 20 seats and row 9 has 44 seats; from row 1 to row 9 is 8 steps, so each step is (4420)/8=3(44-20)/8 = 3 seats per row. Thus row 20 has 20+19(3)=7720 + 19(3) = 77 seats. Since an arithmetic sequence sum depends only on the first and last terms, the total is 202(20+77)=10(97)=970\frac{20}{2}(20+77) = 10(97) = 970. The choice 10001000 comes from a common trap: using 20 as the number of increases, so row 20 becomes 20+20(3)=8020 + 20(3) = 80, then averaging 20 and 80. But there are only 19 increases between row 1 and row 20. The choice 19401940 uses the correct 77 but forgets to divide by 2: 20(20+77)20(20+77) gives twice the sum. The choice 20002000 combines both mistakes: it uses row 20 = 80 and also fails to divide by 2, giving 20(20+80)20(20+80). On exam day, write out the pattern and check the number of intervals: from row 1 to row nn is n1n-1 increases. Then apply the sum formula, and don't forget the factor n2\frac{n}{2}.

Question 12

The second term of an arithmetic sequence is 99, and the fifth term is 2121. What is the sum of the first 15 terms?

  1. 555555
  2. 525525
  3. 495495 (correct answer)
  4. 465465
Explanation: An arithmetic sequence is built by adding the same difference dd each time. You are told the second term is 99 and the fifth term is 2121, so between those two terms there are 52=35-2=3 steps. That means 219=1221-9=12 is equal to 3d3d, so d=4d=4. Work backward to the first term: since the second term is 99, the first term is 94=59-4=5. Now use the sum formula for the first 15 terms: S15=152[2(5)+(151)(4)]=152(10+56)=152(66)=495.S_{15}=\frac{15}{2}\left[2(5)+(15-1)(4)\right] =\frac{15}{2}(10+56) =\frac{15}{2}(66)=495. So 495495 is the correct sum. The choice 555555 comes from treating the second term, 99, as if it were the first term and then summing 15 terms with that starting value: 152(18+144)=555\frac{15}{2}(18+14\cdot4)=555. The choice 525525 incorrectly combines the second term with the correct 15th term, using an average of 9+612\frac{9+61}{2}, which mixes up which term is the true starting point. The choice 465465 would require the first term to be 33, but then the second term would be 77, not 99; this is an off-by-one indexing error. The key is always to identify a1a_1 and dd before summing. Count the intervals between known terms carefully, then use Sn=n2(a1+an)S_n=\frac n2(a_1+a_n).

Question 13

The sum of the first nn terms of an arithmetic series is Sn=3n22nS_n=3n^2-2n. Which expression gives ana_n, the nnth term?

  1. 3n22n3n^2-2n
  2. 3n23n-2
  3. 6n56n-5 (correct answer)
  4. 6n+16n+1
Explanation: Since an=SnSn1a_n=S_n-S_{n-1}, compute Sn1=3(n1)22(n1)=3n28n+5S_{n-1}=3(n-1)^2-2(n-1)=3n^2-8n+5. Subtracting gives an=(3n22n)(3n28n+5)=6n5a_n=(3n^2-2n)-(3n^2-8n+5)=6n-5. The expression 3n23n-2 is Sn/nS_n/n, 3n22n3n^2-2n is the sum itself, and 6n+16n+1 is an+1a_{n+1} from Sn+1SnS_{n+1}-S_n.

Question 14

An arithmetic sequence has first term 3-3. If the sum of its first 15 terms is 480480, what is the common difference?

  1. 4.375
  2. 4.667
  3. 5 (correct answer)
  4. 5.385
Explanation: Using S15=152[2(3)+14d]=480S_{15}=\frac{15}{2}[2(-3)+14d]=480, we get 45+105d=480-45+105d=480, so d=5d=5. The values 4.3754.375, 4.6674.667, and 5.3855.385 come from counting 16, 15, or 13 intervals between the first and 15th terms instead of 14 intervals.

Question 15

Seven arithmetic means are inserted between 13-13 and 4343. What is the common difference of the resulting sequence?

  1. 569\frac{56}{9}
  2. 7 (correct answer)
  3. 8
  4. 283\frac{28}{3}
Explanation: The resulting sequence has 7+2=97+2=9 terms, hence 88 gaps. Therefore d=43(13)8=568=7d=\frac{43-(-13)}{8}=\frac{56}{8}=7. The value 569\frac{56}{9} uses the number of terms as the number of gaps; 88 comes from dividing by the 7 inserted means; 283\frac{28}{3} uses 6 gaps.

Question 16

The eighth term of an arithmetic sequence is 3131, and the sum of the first eight terms is 136136. What is the first term?

  1. 14-14
  2. 33 (correct answer)
  3. 1717
  4. 3434
Explanation: Since S8=82(a1+31)=4(a1+31)S_8=\frac{8}{2}(a_1+31)=4(a_1+31), 136=4(a1+31)136=4(a_1+31). Thus a1+31=34a_1+31=34, so a1=3a_1=3. The value 14-14 comes from 136/831136/8-31, 1717 is the average of the eight terms, and 3434 is a1+a8a_1+a_8.

Question 17

An arithmetic series has first term 1717, last term 13-13, and sum 3030. What is the common difference?

  1. 3013-\frac{30}{13}
  2. 3014-\frac{30}{14} (correct answer)
  3. 3015-\frac{30}{15}
  4. 3016-\frac{30}{16}
Explanation: Since Sn=n2(1713)=2nS_n=\frac n2(17-13)=2n and Sn=30S_n=30, n=15n=15. There are n1=14n-1=14 intervals, so d=131714=3014d=\frac{-13-17}{14}=\frac{-30}{14}. The other denominators come from using 13, 15, or 16 intervals or terms incorrectly.

Question 18

What is the sum of all positive even integers less than 200200 that are not divisible by 44?

  1. 49004900
  2. 50005000 (correct answer)
  3. 99009900
  4. 1010010100
Explanation: All even integers less than 200 form 2,4,,1982,4,\ldots,198: 99 terms, sum 992(2+198)=9900\frac{99}{2}(2+198)=9900. The multiples of 4 less than 200 form 4,8,,1964,8,\ldots,196: 49 terms, sum 492(4+196)=4900\frac{49}{2}(4+196)=4900. Subtracting the excluded multiples gives 99004900=50009900-4900=5000. The value 49004900 is the excluded sum, 99009900 is all evens less than 200, and 1010010100 is all evens up to and including 200.

Question 19

What is the sum of the arithmetic series 5+8+11++3055+8+11+\cdots+305?

  1. 15,50015{,}500
  2. 15,55015{,}550
  3. 15,65015{,}650
  4. 15,65515{,}655 (correct answer)
Explanation: The common difference is 3, so the number of terms is 30553+1=101\frac{305-5}{3}+1=101. The sum is 1012(5+305)=101155=15,655\frac{101}{2}(5+305)=101\cdot155=15{,}655. The value 15,50015{,}500 results from treating 305305 as the 100th term, not the 101st; 15,55015{,}550 and 15,65015{,}650 are arithmetic slips in computing 101155101\cdot155.

Question 20

For the arithmetic sequence an=72na_n=7-2n, which formula gives the sum of the first nn terms?

  1. n(7n)n(7-n)
  2. n(5n)n(5-n)
  3. n(6+n)n(6+n)
  4. n(6n)n(6-n) (correct answer)
Explanation: The first term is a1=5a_1=5, and the nnth term is 72n7-2n. Therefore Sn=n2(5+72n)=n2(122n)=n(6n)S_n=\frac n2(5+7-2n)=\frac n2(12-2n)=n(6-n). The formula n(7n)n(7-n) results from using 77 as the first term; n(5n)n(5-n) results from using 52n5-2n as the nnth term; n(6+n)n(6+n) results from a sign error when simplifying the average.